About 1H-indole;pyridine;quinoline
1H-indole;pyridine;quinoline (PubChem CID 158744845) has the molecular formula C22H19N3
and a molecular weight of 325.42 g/mol. Its IUPAC name is 1H-indole;pyridine;quinoline.
Molecular Properties
| Compound Name | 1H-indole;pyridine;quinoline |
| PubChem CID | 158744845 |
| Molecular Formula | C22H19N3 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 1H-indole;pyridine;quinoline |
| SMILES | c1ccc2[nH]ccc2c1.c1ccc2ncccc2c1.c1ccncc1 |
| InChI | InChI=1S/C9H7N.C8H7N.C5H5N/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-4-8-7(3-1)5-6-9-8;1-2-4-6-5-3-1/h1-7H;1-6,9H;1-5H |
| InChIKey | IMTIEXMSEFYYMX-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-indole;pyridine;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indole;pyridine;quinoline?
The IUPAC name of 1H-indole;pyridine;quinoline (CID 158744845) is 1H-indole;pyridine;quinoline.
What is the SMILES notation for 1H-indole;pyridine;quinoline?
The canonical SMILES for 1H-indole;pyridine;quinoline is c1ccc2[nH]ccc2c1.c1ccc2ncccc2c1.c1ccncc1.
What is the InChIKey of 1H-indole;pyridine;quinoline?
The InChIKey is IMTIEXMSEFYYMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C8H7N.C5H5N/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-4-8-7(3-1)5-6-9-8;1-2-4-6-5-3-1/h1-7H;1-6,9H;1-5H.
What are the key properties of 1H-indole;pyridine;quinoline?
1H-indole;pyridine;quinoline has a molecular weight of 325.42 g/mol, XLogP of 5.48, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indole;pyridine;quinoline is sourced from PubChem (CID 158744845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).