C22H28N4O4 — CID 158746441
2-aminopyridine-3-carbaldehyde;3-methoxybutan-2-one;2-(1-methoxyethyl)-1,8-naphthyridine (PubChem CID 158746441) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is 2-aminopyridine-3-carbaldehyde;3-methoxybutan-2-one;2-(1-methoxyethyl)-1,8-naphthyridine.
| Compound Name | 2-aminopyridine-3-carbaldehyde;3-methoxybutan-2-one;2-(1-methoxyethyl)-1,8-naphthyridine |
|---|---|
| PubChem CID | 158746441 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 2-aminopyridine-3-carbaldehyde;3-methoxybutan-2-one;2-(1-methoxyethyl)-1,8-naphthyridine |
| SMILES | COC(C)C(C)=O.COC(C)c1ccc2cccnc2n1.Nc1ncccc1C=O |
| InChI | InChI=1S/C11H12N2O.C6H6N2O.C5H10O2/c1-8(14-2)10-6-5-9-4-3-7-12-11(9)13-10;7-6-5(4-9)2-1-3-8-6;1-4(6)5(2)7-3/h3-8H,1-2H3;1-4H,(H2,7,8);5H,1-3H3 |
| InChIKey | IMYGXFLIGFIIRC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 117.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|