C33H56O12 — CID 158748387
tert-butyl prop-2-enoate;1-O,5-O-ditert-butyl 3-O-ethyl 3-acetylpentane-1,3,5-tricarboxylate;ethyl 3-oxobutanoate (PubChem CID 158748387) has the molecular formula C33H56O12 and a molecular weight of 644.80 g/mol. Its IUPAC name is tert-butyl prop-2-enoate;1-O,5-O-ditert-butyl 3-O-ethyl 3-acetylpentane-1,3,5-tricarboxylate;ethyl 3-oxobutanoate.
| Compound Name | tert-butyl prop-2-enoate;1-O,5-O-ditert-butyl 3-O-ethyl 3-acetylpentane-1,3,5-tricarboxylate;ethyl 3-oxobutanoate |
|---|---|
| PubChem CID | 158748387 |
| Molecular Formula | C33H56O12 |
| Molecular Weight | 644.80 g/mol |
| Exact Mass | 644.38 |
| IUPAC Name | tert-butyl prop-2-enoate;1-O,5-O-ditert-butyl 3-O-ethyl 3-acetylpentane-1,3,5-tricarboxylate;ethyl 3-oxobutanoate |
| SMILES | C=CC(=O)OC(C)(C)C.CCOC(=O)C(CCC(=O)OC(C)(C)C)(CCC(=O)OC(C)(C)C)C(C)=O.CCOC(=O)CC(C)=O |
| InChI | InChI=1S/C20H34O7.C7H12O2.C6H10O3/c1-9-25-17(24)20(14(2)21,12-10-15(22)26-18(3,4)5)13-11-16(23)27-19(6,7)8;1-5-6(8)9-7(2,3)4;1-3-9-6(8)4-5(2)7/h9-13H2,1-8H3;5H,1H2,2-4H3;3-4H2,1-2H3 |
| InChIKey | INDVHOALIZKZOH-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 165.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.80 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|