C34H28F6N8O2 — CID 158750735
N-benzyl-5-imidazol-1-yl-4-nitro-2-(trifluoromethyl)aniline;4-N-benzyl-2-imidazol-1-yl-5-(trifluoromethyl)benzene-1,4-diamine (PubChem CID 158750735) has the molecular formula C34H28F6N8O2 and a molecular weight of 694.64 g/mol. Its IUPAC name is N-benzyl-5-imidazol-1-yl-4-nitro-2-(trifluoromethyl)aniline;4-N-benzyl-2-imidazol-1-yl-5-(trifluoromethyl)benzene-1,4-diamine.
| Compound Name | N-benzyl-5-imidazol-1-yl-4-nitro-2-(trifluoromethyl)aniline;4-N-benzyl-2-imidazol-1-yl-5-(trifluoromethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 158750735 |
| Molecular Formula | C34H28F6N8O2 |
| Molecular Weight | 694.64 g/mol |
| Exact Mass | 694.22 |
| IUPAC Name | N-benzyl-5-imidazol-1-yl-4-nitro-2-(trifluoromethyl)aniline;4-N-benzyl-2-imidazol-1-yl-5-(trifluoromethyl)benzene-1,4-diamine |
| SMILES | Nc1cc(C(F)(F)F)c(NCc2ccccc2)cc1-n1ccnc1.O=[N+]([O-])c1cc(C(F)(F)F)c(NCc2ccccc2)cc1-n1ccnc1 |
| InChI | InChI=1S/C17H13F3N4O2.C17H15F3N4/c18-17(19,20)13-8-16(24(25)26)15(23-7-6-21-11-23)9-14(13)22-10-12-4-2-1-3-5-12;18-17(19,20)13-8-14(21)16(24-7-6-22-11-24)9-15(13)23-10-12-4-2-1-3-5-12/h1-9,11,22H,10H2;1-9,11,23H,10,21H2 |
| InChIKey | INLHFXKUOCQMCC-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 128.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.64 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|