C46H46N6O3 — CID 158751261
4-[3-(3-amino-2-methylphenyl)-5-isocyanoindol-1-yl]cyclohexan-1-one;3-[1-(1,4-dioxaspiro[4.5]decan-8-yl)-5-isocyanoindol-3-yl]-2-methylaniline (PubChem CID 158751261) has the molecular formula C46H46N6O3 and a molecular weight of 730.91 g/mol. Its IUPAC name is 4-[3-(3-amino-2-methylphenyl)-5-isocyanoindol-1-yl]cyclohexan-1-one;3-[1-(1,4-dioxaspiro[4.5]decan-8-yl)-5-isocyanoindol-3-yl]-2-methylaniline.
| Compound Name | 4-[3-(3-amino-2-methylphenyl)-5-isocyanoindol-1-yl]cyclohexan-1-one;3-[1-(1,4-dioxaspiro[4.5]decan-8-yl)-5-isocyanoindol-3-yl]-2-methylaniline |
|---|---|
| PubChem CID | 158751261 |
| Molecular Formula | C46H46N6O3 |
| Molecular Weight | 730.91 g/mol |
| Exact Mass | 730.36 |
| IUPAC Name | 4-[3-(3-amino-2-methylphenyl)-5-isocyanoindol-1-yl]cyclohexan-1-one;3-[1-(1,4-dioxaspiro[4.5]decan-8-yl)-5-isocyanoindol-3-yl]-2-methylaniline |
| SMILES | [C-]#[N+]c1ccc2c(c1)c(-c1cccc(N)c1C)cn2C1CCC(=O)CC1.[C-]#[N+]c1ccc2c(c1)c(-c1cccc(N)c1C)cn2C1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C24H25N3O2.C22H21N3O/c1-16-19(4-3-5-22(16)25)21-15-27(23-7-6-17(26-2)14-20(21)23)18-8-10-24(11-9-18)28-12-13-29-24;1-14-18(4-3-5-21(14)23)20-13-25(16-7-9-17(26)10-8-16)22-11-6-15(24-2)12-19(20)22/h3-7,14-15,18H,8-13,25H2,1H3;3-6,11-13,16H,7-10,23H2,1H3 |
| InChIKey | INMXDEFLLKEVQE-UHFFFAOYSA-N |
| XLogP | 11.04 |
| TPSA | 106.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.91 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|