C24H27IO2 — CID 158752999
1-ethenyl-2,3-dihydro-1H-indene;[(Z)-5-(2-iodophenyl)pent-2-enyl] acetate (PubChem CID 158752999) has the molecular formula C24H27IO2 and a molecular weight of 474.38 g/mol. Its IUPAC name is 1-ethenyl-2,3-dihydro-1H-indene;[(Z)-5-(2-iodophenyl)pent-2-enyl] acetate.
| Compound Name | 1-ethenyl-2,3-dihydro-1H-indene;[(Z)-5-(2-iodophenyl)pent-2-enyl] acetate |
|---|---|
| PubChem CID | 158752999 |
| Molecular Formula | C24H27IO2 |
| Molecular Weight | 474.38 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | 1-ethenyl-2,3-dihydro-1H-indene;[(Z)-5-(2-iodophenyl)pent-2-enyl] acetate |
| SMILES | C=CC1CCc2ccccc21.CC(=O)OC/C=C\CCc1ccccc1I |
| InChI | InChI=1S/C13H15IO2.C11H12/c1-11(15)16-10-6-2-3-7-12-8-4-5-9-13(12)14;1-2-9-7-8-10-5-3-4-6-11(9)10/h2,4-6,8-9H,3,7,10H2,1H3;2-6,9H,1,7-8H2/b6-2-; |
| InChIKey | INSFMUXKKGCWAY-FHERWMFHSA-N |
| XLogP | 6.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.38 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|