About 1-ethenyl-2,3-dihydro-1H-indene;[(Z)-5-(2-iodophenyl)pent-2-enyl] acetate
1-ethenyl-2,3-dihydro-1H-indene;[(Z)-5-(2-iodophenyl)pent-2-enyl] acetate (PubChem CID 158752999) has the molecular formula C24H27IO2
and a molecular weight of 474.38 g/mol. Its IUPAC name is 1-ethenyl-2,3-dihydro-1H-indene;[(Z)-5-(2-iodophenyl)pent-2-enyl] acetate.
Molecular Properties
| Compound Name | 1-ethenyl-2,3-dihydro-1H-indene;[(Z)-5-(2-iodophenyl)pent-2-enyl] acetate |
| PubChem CID | 158752999 |
| Molecular Formula | C24H27IO2 |
| Molecular Weight | 474.38 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | 1-ethenyl-2,3-dihydro-1H-indene;[(Z)-5-(2-iodophenyl)pent-2-enyl] acetate |
| SMILES | C=CC1CCc2ccccc21.CC(=O)OC/C=C\CCc1ccccc1I |
| InChI | InChI=1S/C13H15IO2.C11H12/c1-11(15)16-10-6-2-3-7-12-8-4-5-9-13(12)14;1-2-9-7-8-10-5-3-4-6-11(9)10/h2,4-6,8-9H,3,7,10H2,1H3;2-6,9H,1,7-8H2/b6-2-; |
| InChIKey | INSFMUXKKGCWAY-FHERWMFHSA-N |
| XLogP | 6.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.38 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenyl-2,3-dihydro-1H-indene;[(Z)-5-(2-iodophenyl)pent-2-enyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-2,3-dihydro-1H-indene;[(Z)-5-(2-iodophenyl)pent-2-enyl] acetate?
The IUPAC name of 1-ethenyl-2,3-dihydro-1H-indene;[(Z)-5-(2-iodophenyl)pent-2-enyl] acetate (CID 158752999) is 1-ethenyl-2,3-dihydro-1H-indene;[(Z)-5-(2-iodophenyl)pent-2-enyl] acetate.
What is the SMILES notation for 1-ethenyl-2,3-dihydro-1H-indene;[(Z)-5-(2-iodophenyl)pent-2-enyl] acetate?
The canonical SMILES for 1-ethenyl-2,3-dihydro-1H-indene;[(Z)-5-(2-iodophenyl)pent-2-enyl] acetate is C=CC1CCc2ccccc21.CC(=O)OC/C=C\CCc1ccccc1I.
What is the InChIKey of 1-ethenyl-2,3-dihydro-1H-indene;[(Z)-5-(2-iodophenyl)pent-2-enyl] acetate?
The InChIKey is INSFMUXKKGCWAY-FHERWMFHSA-N. The full InChI is InChI=1S/C13H15IO2.C11H12/c1-11(15)16-10-6-2-3-7-12-8-4-5-9-13(12)14;1-2-9-7-8-10-5-3-4-6-11(9)10/h2,4-6,8-9H,3,7,10H2,1H3;2-6,9H,1,7-8H2/b6-2-;.
What are the key properties of 1-ethenyl-2,3-dihydro-1H-indene;[(Z)-5-(2-iodophenyl)pent-2-enyl] acetate?
1-ethenyl-2,3-dihydro-1H-indene;[(Z)-5-(2-iodophenyl)pent-2-enyl] acetate has a molecular weight of 474.38 g/mol, XLogP of 6.25, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-2,3-dihydro-1H-indene;[(Z)-5-(2-iodophenyl)pent-2-enyl] acetate is sourced from PubChem (CID 158752999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).