C16H30O — CID 158753261
(E,2S,3S)-2-[(1R,2S,4R,5S)-5-ethyl-2,4-dimethylcyclohexyl]hex-4-en-3-ol (PubChem CID 158753261) has the molecular formula C16H30O and a molecular weight of 238.41 g/mol. Its IUPAC name is (E,2S,3S)-2-[(1R,2S,4R,5S)-5-ethyl-2,4-dimethylcyclohexyl]hex-4-en-3-ol.
| Compound Name | (E,2S,3S)-2-[(1R,2S,4R,5S)-5-ethyl-2,4-dimethylcyclohexyl]hex-4-en-3-ol |
|---|---|
| PubChem CID | 158753261 |
| Molecular Formula | C16H30O |
| Molecular Weight | 238.41 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | (E,2S,3S)-2-[(1R,2S,4R,5S)-5-ethyl-2,4-dimethylcyclohexyl]hex-4-en-3-ol |
| SMILES | C/C=C/[C@H](O)[C@@H](C)[C@@H]1C[C@H](CC)[C@H](C)C[C@@H]1C |
| InChI | InChI=1S/C16H30O/c1-6-8-16(17)13(5)15-10-14(7-2)11(3)9-12(15)4/h6,8,11-17H,7,9-10H2,1-5H3/b8-6+/t11-,12+,13+,14+,15-,16+/m1/s1 |
| InChIKey | INSZZZDWOQOCKX-CNYYOPIBSA-N |
| XLogP | 4.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|