C20H32N6O2 — CID 158753870
2-ethyl-7-methyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one;2-ethyl-5,6,7,8-tetrahydro-3H-pyrido[3,4-d]pyrimidin-4-one;methane (PubChem CID 158753870) has the molecular formula C20H32N6O2 and a molecular weight of 388.52 g/mol. Its IUPAC name is 2-ethyl-7-methyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one;2-ethyl-5,6,7,8-tetrahydro-3H-pyrido[3,4-d]pyrimidin-4-one;methane.
| Compound Name | 2-ethyl-7-methyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one;2-ethyl-5,6,7,8-tetrahydro-3H-pyrido[3,4-d]pyrimidin-4-one;methane |
|---|---|
| PubChem CID | 158753870 |
| Molecular Formula | C20H32N6O2 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 2-ethyl-7-methyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one;2-ethyl-5,6,7,8-tetrahydro-3H-pyrido[3,4-d]pyrimidin-4-one;methane |
| SMILES | C.CCc1nc2c(c(=O)[nH]1)CCN(C)C2.CCc1nc2c(c(=O)[nH]1)CCNC2 |
| InChI | InChI=1S/C10H15N3O.C9H13N3O.CH4/c1-3-9-11-8-6-13(2)5-4-7(8)10(14)12-9;1-2-8-11-7-5-10-4-3-6(7)9(13)12-8;/h3-6H2,1-2H3,(H,11,12,14);10H,2-5H2,1H3,(H,11,12,13);1H4 |
| InChIKey | INUWRXDEFDSIOI-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |