About pyrrolidine-2,5-dione;sulfanylidenemolybdenum
pyrrolidine-2,5-dione;sulfanylidenemolybdenum (PubChem CID 158754348) has the molecular formula C4H5MoNO2S
and a molecular weight of 227.10 g/mol. Its IUPAC name is pyrrolidine-2,5-dione;sulfanylidenemolybdenum.
Molecular Properties
| Compound Name | pyrrolidine-2,5-dione;sulfanylidenemolybdenum |
| PubChem CID | 158754348 |
| Molecular Formula | C4H5MoNO2S |
| Molecular Weight | 227.10 g/mol |
| Exact Mass | 228.91 |
| IUPAC Name | pyrrolidine-2,5-dione;sulfanylidenemolybdenum |
| SMILES | O=C1CCC(=O)N1.S=[Mo] |
| InChI | InChI=1S/C4H5NO2.Mo.S/c6-3-1-2-4(7)5-3;;/h1-2H2,(H,5,6,7);; |
| InChIKey | INWJLZUHSKZRBZ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.10 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze pyrrolidine-2,5-dione;sulfanylidenemolybdenum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidine-2,5-dione;sulfanylidenemolybdenum?
The IUPAC name of pyrrolidine-2,5-dione;sulfanylidenemolybdenum (CID 158754348) is pyrrolidine-2,5-dione;sulfanylidenemolybdenum.
What is the SMILES notation for pyrrolidine-2,5-dione;sulfanylidenemolybdenum?
The canonical SMILES for pyrrolidine-2,5-dione;sulfanylidenemolybdenum is O=C1CCC(=O)N1.S=[Mo].
What is the InChIKey of pyrrolidine-2,5-dione;sulfanylidenemolybdenum?
The InChIKey is INWJLZUHSKZRBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2.Mo.S/c6-3-1-2-4(7)5-3;;/h1-2H2,(H,5,6,7);;.
What are the key properties of pyrrolidine-2,5-dione;sulfanylidenemolybdenum?
pyrrolidine-2,5-dione;sulfanylidenemolybdenum has a molecular weight of 227.10 g/mol, XLogP of 0.07, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidine-2,5-dione;sulfanylidenemolybdenum is sourced from PubChem (CID 158754348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).