C28H20Br2N6O2 — CID 158755344
13-bromo-5-methyl-5,10,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),3,7,11(16),12,14-heptaene;4-(5-bromo-3-nitro-2-pyridinyl)-1-methylindole (PubChem CID 158755344) has the molecular formula C28H20Br2N6O2 and a molecular weight of 632.32 g/mol. Its IUPAC name is 13-bromo-5-methyl-5,10,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),3,7,11(16),12,14-heptaene;4-(5-bromo-3-nitro-2-pyridinyl)-1-methylindole.
| Compound Name | 13-bromo-5-methyl-5,10,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),3,7,11(16),12,14-heptaene;4-(5-bromo-3-nitro-2-pyridinyl)-1-methylindole |
|---|---|
| PubChem CID | 158755344 |
| Molecular Formula | C28H20Br2N6O2 |
| Molecular Weight | 632.32 g/mol |
| Exact Mass | 630.00 |
| IUPAC Name | 13-bromo-5-methyl-5,10,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),3,7,11(16),12,14-heptaene;4-(5-bromo-3-nitro-2-pyridinyl)-1-methylindole |
| SMILES | Cn1ccc2c(-c3ncc(Br)cc3[N+](=O)[O-])cccc21.Cn1ccc2c3c(ccc21)[nH]c1cc(Br)cnc13 |
| InChI | InChI=1S/C14H10BrN3O2.C14H10BrN3/c1-17-6-5-10-11(3-2-4-12(10)17)14-13(18(19)20)7-9(15)8-16-14;1-18-5-4-9-12(18)3-2-10-13(9)14-11(17-10)6-8(15)7-16-14/h2-8H,1H3;2-7,17H,1H3 |
| InChIKey | INZQWXVQFIERCV-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.32 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|