About 5,5-dimethylnonane;5-methylnonane
5,5-dimethylnonane;5-methylnonane (PubChem CID 158755954) has the molecular formula C21H46
and a molecular weight of 298.60 g/mol. Its IUPAC name is 5,5-dimethylnonane;5-methylnonane.
Molecular Properties
| Compound Name | 5,5-dimethylnonane;5-methylnonane |
| PubChem CID | 158755954 |
| Molecular Formula | C21H46 |
| Molecular Weight | 298.60 g/mol |
| Exact Mass | 298.36 |
| IUPAC Name | 5,5-dimethylnonane;5-methylnonane |
| SMILES | CCCCC(C)(C)CCCC.CCCCC(C)CCCC |
| InChI | InChI=1S/C11H24.C10H22/c1-5-7-9-11(3,4)10-8-6-2;1-4-6-8-10(3)9-7-5-2/h5-10H2,1-4H3;10H,4-9H2,1-3H3 |
| InChIKey | IOBSGYLVVWMFJX-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.60 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5,5-dimethylnonane;5-methylnonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethylnonane;5-methylnonane?
The IUPAC name of 5,5-dimethylnonane;5-methylnonane (CID 158755954) is 5,5-dimethylnonane;5-methylnonane.
What is the SMILES notation for 5,5-dimethylnonane;5-methylnonane?
The canonical SMILES for 5,5-dimethylnonane;5-methylnonane is CCCCC(C)(C)CCCC.CCCCC(C)CCCC.
What is the InChIKey of 5,5-dimethylnonane;5-methylnonane?
The InChIKey is IOBSGYLVVWMFJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24.C10H22/c1-5-7-9-11(3,4)10-8-6-2;1-4-6-8-10(3)9-7-5-2/h5-10H2,1-4H3;10H,4-9H2,1-3H3.
What are the key properties of 5,5-dimethylnonane;5-methylnonane?
5,5-dimethylnonane;5-methylnonane has a molecular weight of 298.60 g/mol, XLogP of 8.40, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethylnonane;5-methylnonane is sourced from PubChem (CID 158755954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).