C26H25N5OS2 — CID 158756066
1-[1-[4-hydroxy-5-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophen-3-yl]ethylideneamino]-3-[3-(2H-tetrazol-5-yl)phenyl]propane-2-thione (PubChem CID 158756066) has the molecular formula C26H25N5OS2 and a molecular weight of 487.65 g/mol. Its IUPAC name is 1-[1-[4-hydroxy-5-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophen-3-yl]ethylideneamino]-3-[3-(2H-tetrazol-5-yl)phenyl]propane-2-thione.
| Compound Name | 1-[1-[4-hydroxy-5-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophen-3-yl]ethylideneamino]-3-[3-(2H-tetrazol-5-yl)phenyl]propane-2-thione |
|---|---|
| PubChem CID | 158756066 |
| Molecular Formula | C26H25N5OS2 |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | 1-[1-[4-hydroxy-5-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophen-3-yl]ethylideneamino]-3-[3-(2H-tetrazol-5-yl)phenyl]propane-2-thione |
| SMILES | C/C(=N\CC(=S)Cc1cccc(-c2nn[nH]n2)c1)c1csc(-c2ccc3c(c2)CCCC3)c1O |
| InChI | InChI=1S/C26H25N5OS2/c1-16(27-14-22(33)12-17-5-4-8-21(11-17)26-28-30-31-29-26)23-15-34-25(24(23)32)20-10-9-18-6-2-3-7-19(18)13-20/h4-5,8-11,13,15,32H,2-3,6-7,12,14H2,1H3,(H,28,29,30,31)/b27-16+ |
| InChIKey | KSJVHLMGFINYJP-JVWAILMASA-N |
| XLogP | 5.60 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|