C32H27BrN2O4S2 — CID 158756276
1-(benzenesulfonyl)-4-bromo-3-methylindole;1-(benzenesulfonyl)-4-ethenyl-3-methylindole (PubChem CID 158756276) has the molecular formula C32H27BrN2O4S2 and a molecular weight of 647.62 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-bromo-3-methylindole;1-(benzenesulfonyl)-4-ethenyl-3-methylindole.
| Compound Name | 1-(benzenesulfonyl)-4-bromo-3-methylindole;1-(benzenesulfonyl)-4-ethenyl-3-methylindole |
|---|---|
| PubChem CID | 158756276 |
| Molecular Formula | C32H27BrN2O4S2 |
| Molecular Weight | 647.62 g/mol |
| Exact Mass | 646.06 |
| IUPAC Name | 1-(benzenesulfonyl)-4-bromo-3-methylindole;1-(benzenesulfonyl)-4-ethenyl-3-methylindole |
| SMILES | C=Cc1cccc2c1c(C)cn2S(=O)(=O)c1ccccc1.Cc1cn(S(=O)(=O)c2ccccc2)c2cccc(Br)c12 |
| InChI | InChI=1S/C17H15NO2S.C15H12BrNO2S/c1-3-14-8-7-11-16-17(14)13(2)12-18(16)21(19,20)15-9-5-4-6-10-15;1-11-10-17(14-9-5-8-13(16)15(11)14)20(18,19)12-6-3-2-4-7-12/h3-12H,1H2,2H3;2-10H,1H3 |
| InChIKey | IOCQPCUJVPPPET-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.62 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |