C28H34N2O3Si — CID 158756883
[diphenyl-[(2S)-pyrrolidin-2-yl]methoxy]-trimethylsilane;[(E)-2-nitroethenyl]benzene (PubChem CID 158756883) has the molecular formula C28H34N2O3Si and a molecular weight of 474.68 g/mol. Its IUPAC name is [diphenyl-[(2S)-pyrrolidin-2-yl]methoxy]-trimethylsilane;[(E)-2-nitroethenyl]benzene.
| Compound Name | [diphenyl-[(2S)-pyrrolidin-2-yl]methoxy]-trimethylsilane;[(E)-2-nitroethenyl]benzene |
|---|---|
| PubChem CID | 158756883 |
| Molecular Formula | C28H34N2O3Si |
| Molecular Weight | 474.68 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | [diphenyl-[(2S)-pyrrolidin-2-yl]methoxy]-trimethylsilane;[(E)-2-nitroethenyl]benzene |
| SMILES | C[Si](C)(C)OC(c1ccccc1)(c1ccccc1)[C@@H]1CCCN1.O=[N+]([O-])/C=C/c1ccccc1 |
| InChI | InChI=1S/C20H27NOSi.C8H7NO2/c1-23(2,3)22-20(19-15-10-16-21-19,17-11-6-4-7-12-17)18-13-8-5-9-14-18;10-9(11)7-6-8-4-2-1-3-5-8/h4-9,11-14,19,21H,10,15-16H2,1-3H3;1-7H/b;7-6+/t19-;/m0./s1 |
| InChIKey | IOEJWXFOWYEAGS-SZKCMNLOSA-N |
| XLogP | 6.47 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.68 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|