About sulfanium;N-decyldecan-1-amine;chloride
sulfanium;N-decyldecan-1-amine;chloride (PubChem CID 158756952) has the molecular formula C20H46ClNS
and a molecular weight of 368.12 g/mol. Its IUPAC name is sulfanium;N-decyldecan-1-amine;chloride.
Molecular Properties
| Compound Name | sulfanium;N-decyldecan-1-amine;chloride |
| PubChem CID | 158756952 |
| Molecular Formula | C20H46ClNS |
| Molecular Weight | 368.12 g/mol |
| Exact Mass | 367.30 |
| IUPAC Name | sulfanium;N-decyldecan-1-amine;chloride |
| SMILES | CCCCCCCCCCNCCCCCCCCCC.[Cl-].[SH3+] |
| InChI | InChI=1S/C20H43N.ClH.H2S/c1-3-5-7-9-11-13-15-17-19-21-20-18-16-14-12-10-8-6-4-2;;/h21H,3-20H2,1-2H3;1H;1H2 |
| InChIKey | AMDDRGCJTJFAHO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.12 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze sulfanium;N-decyldecan-1-amine;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfanium;N-decyldecan-1-amine;chloride?
The IUPAC name of sulfanium;N-decyldecan-1-amine;chloride (CID 158756952) is sulfanium;N-decyldecan-1-amine;chloride.
What is the SMILES notation for sulfanium;N-decyldecan-1-amine;chloride?
The canonical SMILES for sulfanium;N-decyldecan-1-amine;chloride is CCCCCCCCCCNCCCCCCCCCC.[Cl-].[SH3+].
What is the InChIKey of sulfanium;N-decyldecan-1-amine;chloride?
The InChIKey is AMDDRGCJTJFAHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H43N.ClH.H2S/c1-3-5-7-9-11-13-15-17-19-21-20-18-16-14-12-10-8-6-4-2;;/h21H,3-20H2,1-2H3;1H;1H2.
What are the key properties of sulfanium;N-decyldecan-1-amine;chloride?
sulfanium;N-decyldecan-1-amine;chloride has a molecular weight of 368.12 g/mol, XLogP of 3.06, 18 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sulfanium;N-decyldecan-1-amine;chloride is sourced from PubChem (CID 158756952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).