C38H38N2O10S2V — CID 158757468
1,4-bis[2-hydroxy-2-(methylamino)ethoxy]thioxanthen-9-one;1,4-bis(oxiran-2-ylmethoxy)thioxanthen-9-one;vanadium (PubChem CID 158757468) has the molecular formula C38H38N2O10S2V and a molecular weight of 797.80 g/mol. Its IUPAC name is 1,4-bis[2-hydroxy-2-(methylamino)ethoxy]thioxanthen-9-one;1,4-bis(oxiran-2-ylmethoxy)thioxanthen-9-one;vanadium.
| Compound Name | 1,4-bis[2-hydroxy-2-(methylamino)ethoxy]thioxanthen-9-one;1,4-bis(oxiran-2-ylmethoxy)thioxanthen-9-one;vanadium |
|---|---|
| PubChem CID | 158757468 |
| Molecular Formula | C38H38N2O10S2V |
| Molecular Weight | 797.80 g/mol |
| Exact Mass | 797.14 |
| IUPAC Name | 1,4-bis[2-hydroxy-2-(methylamino)ethoxy]thioxanthen-9-one;1,4-bis(oxiran-2-ylmethoxy)thioxanthen-9-one;vanadium |
| SMILES | CNC(O)COc1ccc(OCC(O)NC)c2c(=O)c3ccccc3sc12.O=c1c2ccccc2sc2c(OCC3CO3)ccc(OCC3CO3)c12.[V] |
| InChI | InChI=1S/C19H22N2O5S.C19H16O5S.V/c1-20-15(22)9-25-12-7-8-13(26-10-16(23)21-2)19-17(12)18(24)11-5-3-4-6-14(11)27-19;20-18-13-3-1-2-4-16(13)25-19-15(24-10-12-8-22-12)6-5-14(17(18)19)23-9-11-7-21-11;/h3-8,15-16,20-23H,9-10H2,1-2H3;1-6,11-12H,7-10H2; |
| InChIKey | IOGCKSGFWYDJEA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 160.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.80 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|