C23H22F3N5O — CID 158757852
7-[1-phenyl-5-[2-(trifluoromethoxy)phenyl]pentyl]-2H-triazolo[4,5-b]pyridin-5-amine (PubChem CID 158757852) has the molecular formula C23H22F3N5O and a molecular weight of 441.46 g/mol. Its IUPAC name is 7-[1-phenyl-5-[2-(trifluoromethoxy)phenyl]pentyl]-2H-triazolo[4,5-b]pyridin-5-amine.
| Compound Name | 7-[1-phenyl-5-[2-(trifluoromethoxy)phenyl]pentyl]-2H-triazolo[4,5-b]pyridin-5-amine |
|---|---|
| PubChem CID | 158757852 |
| Molecular Formula | C23H22F3N5O |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 7-[1-phenyl-5-[2-(trifluoromethoxy)phenyl]pentyl]-2H-triazolo[4,5-b]pyridin-5-amine |
| SMILES | Nc1cc(C(CCCCc2ccccc2OC(F)(F)F)c2ccccc2)c2n[nH]nc2n1 |
| InChI | InChI=1S/C23H22F3N5O/c24-23(25,26)32-19-13-7-5-11-16(19)10-4-6-12-17(15-8-2-1-3-9-15)18-14-20(27)28-22-21(18)29-31-30-22/h1-3,5,7-9,11,13-14,17H,4,6,10,12H2,(H3,27,28,29,30,31) |
| InChIKey | IOHHFDISIQNKBP-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|