About 6-tert-butylthieno[2,3-b]pyridine;ethane
6-tert-butylthieno[2,3-b]pyridine;ethane (PubChem CID 158757924) has the molecular formula C13H19NS
and a molecular weight of 221.37 g/mol. Its IUPAC name is 6-tert-butylthieno[2,3-b]pyridine;ethane.
Molecular Properties
| Compound Name | 6-tert-butylthieno[2,3-b]pyridine;ethane |
| PubChem CID | 158757924 |
| Molecular Formula | C13H19NS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 6-tert-butylthieno[2,3-b]pyridine;ethane |
| SMILES | CC.CC(C)(C)c1ccc2ccsc2n1 |
| InChI | InChI=1S/C11H13NS.C2H6/c1-11(2,3)9-5-4-8-6-7-13-10(8)12-9;1-2/h4-7H,1-3H3;1-2H3 |
| InChIKey | IOHNFSAMTFWBDQ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-tert-butylthieno[2,3-b]pyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butylthieno[2,3-b]pyridine;ethane?
The IUPAC name of 6-tert-butylthieno[2,3-b]pyridine;ethane (CID 158757924) is 6-tert-butylthieno[2,3-b]pyridine;ethane.
What is the SMILES notation for 6-tert-butylthieno[2,3-b]pyridine;ethane?
The canonical SMILES for 6-tert-butylthieno[2,3-b]pyridine;ethane is CC.CC(C)(C)c1ccc2ccsc2n1.
What is the InChIKey of 6-tert-butylthieno[2,3-b]pyridine;ethane?
The InChIKey is IOHNFSAMTFWBDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NS.C2H6/c1-11(2,3)9-5-4-8-6-7-13-10(8)12-9;1-2/h4-7H,1-3H3;1-2H3.
What are the key properties of 6-tert-butylthieno[2,3-b]pyridine;ethane?
6-tert-butylthieno[2,3-b]pyridine;ethane has a molecular weight of 221.37 g/mol, XLogP of 4.62, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butylthieno[2,3-b]pyridine;ethane is sourced from PubChem (CID 158757924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).