About acetonitrile oxide;but-2-yne;3,4,5-trimethyl-1,2-oxazole
acetonitrile oxide;but-2-yne;3,4,5-trimethyl-1,2-oxazole (PubChem CID 158758168) has the molecular formula C12H18N2O2
and a molecular weight of 222.29 g/mol. Its IUPAC name is acetonitrile oxide;but-2-yne;3,4,5-trimethyl-1,2-oxazole.
Molecular Properties
| Compound Name | acetonitrile oxide;but-2-yne;3,4,5-trimethyl-1,2-oxazole |
| PubChem CID | 158758168 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | acetonitrile oxide;but-2-yne;3,4,5-trimethyl-1,2-oxazole |
| SMILES | CC#CC.CC#[N+][O-].Cc1noc(C)c1C |
| InChI | InChI=1S/C6H9NO.C4H6.C2H3NO/c1-4-5(2)7-8-6(4)3;1-3-4-2;1-2-3-4/h1-3H3;1-2H3;1H3 |
| InChIKey | IOIIXFNTLZDHQE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 53.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile oxide;but-2-yne;3,4,5-trimethyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile oxide;but-2-yne;3,4,5-trimethyl-1,2-oxazole?
The IUPAC name of acetonitrile oxide;but-2-yne;3,4,5-trimethyl-1,2-oxazole (CID 158758168) is acetonitrile oxide;but-2-yne;3,4,5-trimethyl-1,2-oxazole.
What is the SMILES notation for acetonitrile oxide;but-2-yne;3,4,5-trimethyl-1,2-oxazole?
The canonical SMILES for acetonitrile oxide;but-2-yne;3,4,5-trimethyl-1,2-oxazole is CC#CC.CC#[N+][O-].Cc1noc(C)c1C.
What is the InChIKey of acetonitrile oxide;but-2-yne;3,4,5-trimethyl-1,2-oxazole?
The InChIKey is IOIIXFNTLZDHQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO.C4H6.C2H3NO/c1-4-5(2)7-8-6(4)3;1-3-4-2;1-2-3-4/h1-3H3;1-2H3;1H3.
What are the key properties of acetonitrile oxide;but-2-yne;3,4,5-trimethyl-1,2-oxazole?
acetonitrile oxide;but-2-yne;3,4,5-trimethyl-1,2-oxazole has a molecular weight of 222.29 g/mol, XLogP of 3.47, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile oxide;but-2-yne;3,4,5-trimethyl-1,2-oxazole is sourced from PubChem (CID 158758168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).