C28H30N10O4 — CID 158759260
2-[(Z)-2-[3-(3-methoxy-5-methylphenyl)-1,2,4-triazol-1-yl]ethenyl]-5-methyl-1,3,4-oxadiazole;(Z)-3-[3-(3-methoxy-5-methylphenyl)-1,2,4-triazol-1-yl]prop-2-enehydrazide (PubChem CID 158759260) has the molecular formula C28H30N10O4 and a molecular weight of 570.61 g/mol. Its IUPAC name is 2-[(Z)-2-[3-(3-methoxy-5-methylphenyl)-1,2,4-triazol-1-yl]ethenyl]-5-methyl-1,3,4-oxadiazole;(Z)-3-[3-(3-methoxy-5-methylphenyl)-1,2,4-triazol-1-yl]prop-2-enehydrazide.
| Compound Name | 2-[(Z)-2-[3-(3-methoxy-5-methylphenyl)-1,2,4-triazol-1-yl]ethenyl]-5-methyl-1,3,4-oxadiazole;(Z)-3-[3-(3-methoxy-5-methylphenyl)-1,2,4-triazol-1-yl]prop-2-enehydrazide |
|---|---|
| PubChem CID | 158759260 |
| Molecular Formula | C28H30N10O4 |
| Molecular Weight | 570.61 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | 2-[(Z)-2-[3-(3-methoxy-5-methylphenyl)-1,2,4-triazol-1-yl]ethenyl]-5-methyl-1,3,4-oxadiazole;(Z)-3-[3-(3-methoxy-5-methylphenyl)-1,2,4-triazol-1-yl]prop-2-enehydrazide |
| SMILES | COc1cc(C)cc(-c2ncn(/C=C\C(=O)NN)n2)c1.COc1cc(C)cc(-c2ncn(/C=C\c3nnc(C)o3)n2)c1 |
| InChI | InChI=1S/C15H15N5O2.C13H15N5O2/c1-10-6-12(8-13(7-10)21-3)15-16-9-20(19-15)5-4-14-18-17-11(2)22-14;1-9-5-10(7-11(6-9)20-2)13-15-8-18(17-13)4-3-12(19)16-14/h4-9H,1-3H3;3-8H,14H2,1-2H3,(H,16,19)/b5-4-;4-3- |
| InChIKey | IOLLPXNOQDWPJZ-PIWOIJDRSA-N |
| XLogP | 3.30 |
| TPSA | 173.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.61 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|