C37H39Cl2N5O5 — CID 158759758
6-amino-5-chloro-3H-1,3-benzoxazol-2-one;5-chloro-6-[[2-hydroxy-3-(2-phenylpropan-2-yl)-5-(2,4,4-trimethylpentan-2-yl)phenyl]diazenyl]-3H-1,3-benzoxazol-2-one (PubChem CID 158759758) has the molecular formula C37H39Cl2N5O5 and a molecular weight of 704.66 g/mol. Its IUPAC name is 6-amino-5-chloro-3H-1,3-benzoxazol-2-one;5-chloro-6-[[2-hydroxy-3-(2-phenylpropan-2-yl)-5-(2,4,4-trimethylpentan-2-yl)phenyl]diazenyl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-amino-5-chloro-3H-1,3-benzoxazol-2-one;5-chloro-6-[[2-hydroxy-3-(2-phenylpropan-2-yl)-5-(2,4,4-trimethylpentan-2-yl)phenyl]diazenyl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 158759758 |
| Molecular Formula | C37H39Cl2N5O5 |
| Molecular Weight | 704.66 g/mol |
| Exact Mass | 703.23 |
| IUPAC Name | 6-amino-5-chloro-3H-1,3-benzoxazol-2-one;5-chloro-6-[[2-hydroxy-3-(2-phenylpropan-2-yl)-5-(2,4,4-trimethylpentan-2-yl)phenyl]diazenyl]-3H-1,3-benzoxazol-2-one |
| SMILES | CC(C)(C)CC(C)(C)c1cc(/N=N/c2cc3oc(=O)[nH]c3cc2Cl)c(O)c(C(C)(C)c2ccccc2)c1.Nc1cc2oc(=O)[nH]c2cc1Cl |
| InChI | InChI=1S/C30H34ClN3O3.C7H5ClN2O2/c1-28(2,3)17-29(4,5)19-13-20(30(6,7)18-11-9-8-10-12-18)26(35)24(14-19)34-33-22-16-25-23(15-21(22)31)32-27(36)37-25;8-3-1-5-6(2-4(3)9)12-7(11)10-5/h8-16,35H,17H2,1-7H3,(H,32,36);1-2H,9H2,(H,10,11)/b34-33+; |
| InChIKey | IONAUMFSMLOCKW-GGTLNOMSSA-N |
| XLogP | 10.29 |
| TPSA | 162.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.66 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|