C38H36N4O6 — CID 158760959
2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanenitrile;2-hydroxy-3-methoxy-3,3-diphenylpropanenitrile (PubChem CID 158760959) has the molecular formula C38H36N4O6 and a molecular weight of 644.73 g/mol. Its IUPAC name is 2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanenitrile;2-hydroxy-3-methoxy-3,3-diphenylpropanenitrile.
| Compound Name | 2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanenitrile;2-hydroxy-3-methoxy-3,3-diphenylpropanenitrile |
|---|---|
| PubChem CID | 158760959 |
| Molecular Formula | C38H36N4O6 |
| Molecular Weight | 644.73 g/mol |
| Exact Mass | 644.26 |
| IUPAC Name | 2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanenitrile;2-hydroxy-3-methoxy-3,3-diphenylpropanenitrile |
| SMILES | COC(c1ccccc1)(c1ccccc1)C(O)C#N.COc1cc(OC)nc(OC(C#N)C(OC)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C22H21N3O4.C16H15NO2/c1-26-19-14-20(27-2)25-21(24-19)29-18(15-23)22(28-3,16-10-6-4-7-11-16)17-12-8-5-9-13-17;1-19-16(15(18)12-17,13-8-4-2-5-9-13)14-10-6-3-7-11-14/h4-14,18H,1-3H3;2-11,15,18H,1H3 |
| InChIKey | IOQVIWWYDPZWGG-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 139.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.73 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|