C18H22N4O2 — CID 158761114
3,5-dimethylbenzene-1,2-diamine;5,7-dimethyl-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 158761114) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 3,5-dimethylbenzene-1,2-diamine;5,7-dimethyl-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 3,5-dimethylbenzene-1,2-diamine;5,7-dimethyl-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 158761114 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 3,5-dimethylbenzene-1,2-diamine;5,7-dimethyl-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | Cc1cc(C)c(N)c(N)c1.Cc1cc(C)c2[nH]c(=O)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C10H10N2O2.C8H12N2/c1-5-3-6(2)8-7(4-5)11-9(13)10(14)12-8;1-5-3-6(2)8(10)7(9)4-5/h3-4H,1-2H3,(H,11,13)(H,12,14);3-4H,9-10H2,1-2H3 |
| InChIKey | IORIXOYGFRXUMZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 117.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|