C12H13NO3 — CID 158762688
3-(hydroxymethyl)-1,2,5-trimethylindole-4,7-dione (PubChem CID 158762688) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is 3-(hydroxymethyl)-1,2,5-trimethylindole-4,7-dione.
| Compound Name | 3-(hydroxymethyl)-1,2,5-trimethylindole-4,7-dione |
|---|---|
| PubChem CID | 158762688 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 3-(hydroxymethyl)-1,2,5-trimethylindole-4,7-dione |
| SMILES | CC1=CC(=O)c2c(c(CO)c(C)n2C)C1=O |
| InChI | InChI=1S/C12H13NO3/c1-6-4-9(15)11-10(12(6)16)8(5-14)7(2)13(11)3/h4,14H,5H2,1-3H3 |
| InChIKey | ZTULJZVZSBSKNA-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|