About 1-isocyano-4-methylpentane-3-thiol;2-propan-2-ylthiirane
1-isocyano-4-methylpentane-3-thiol;2-propan-2-ylthiirane (PubChem CID 158762810) has the molecular formula C12H23NS2
and a molecular weight of 245.46 g/mol. Its IUPAC name is 1-isocyano-4-methylpentane-3-thiol;2-propan-2-ylthiirane.
Molecular Properties
| Compound Name | 1-isocyano-4-methylpentane-3-thiol;2-propan-2-ylthiirane |
| PubChem CID | 158762810 |
| Molecular Formula | C12H23NS2 |
| Molecular Weight | 245.46 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 1-isocyano-4-methylpentane-3-thiol;2-propan-2-ylthiirane |
| SMILES | CC(C)C1CS1.[C-]#[N+]CCC(S)C(C)C |
| InChI | InChI=1S/C7H13NS.C5H10S/c1-6(2)7(9)4-5-8-3;1-4(2)5-3-6-5/h6-7,9H,4-5H2,1-2H3;4-5H,3H2,1-2H3 |
| InChIKey | IOWQQCLZUFACMT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 4.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-isocyano-4-methylpentane-3-thiol;2-propan-2-ylthiirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-isocyano-4-methylpentane-3-thiol;2-propan-2-ylthiirane?
The IUPAC name of 1-isocyano-4-methylpentane-3-thiol;2-propan-2-ylthiirane (CID 158762810) is 1-isocyano-4-methylpentane-3-thiol;2-propan-2-ylthiirane.
What is the SMILES notation for 1-isocyano-4-methylpentane-3-thiol;2-propan-2-ylthiirane?
The canonical SMILES for 1-isocyano-4-methylpentane-3-thiol;2-propan-2-ylthiirane is CC(C)C1CS1.[C-]#[N+]CCC(S)C(C)C.
What is the InChIKey of 1-isocyano-4-methylpentane-3-thiol;2-propan-2-ylthiirane?
The InChIKey is IOWQQCLZUFACMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NS.C5H10S/c1-6(2)7(9)4-5-8-3;1-4(2)5-3-6-5/h6-7,9H,4-5H2,1-2H3;4-5H,3H2,1-2H3.
What are the key properties of 1-isocyano-4-methylpentane-3-thiol;2-propan-2-ylthiirane?
1-isocyano-4-methylpentane-3-thiol;2-propan-2-ylthiirane has a molecular weight of 245.46 g/mol, XLogP of 4.01, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-isocyano-4-methylpentane-3-thiol;2-propan-2-ylthiirane is sourced from PubChem (CID 158762810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).