About [1-(2-chloro-4,6-dimethylphenyl)-3-(4,4-dimethylcyclohexyl)propoxy]-triethylsilane
[1-(2-chloro-4,6-dimethylphenyl)-3-(4,4-dimethylcyclohexyl)propoxy]-triethylsilane (PubChem CID 158762913) has the molecular formula C25H43ClOSi
and a molecular weight of 423.16 g/mol. Its IUPAC name is [1-(2-chloro-4,6-dimethylphenyl)-3-(4,4-dimethylcyclohexyl)propoxy]-triethylsilane.
Molecular Properties
| Compound Name | [1-(2-chloro-4,6-dimethylphenyl)-3-(4,4-dimethylcyclohexyl)propoxy]-triethylsilane |
| PubChem CID | 158762913 |
| Molecular Formula | C25H43ClOSi |
| Molecular Weight | 423.16 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | [1-(2-chloro-4,6-dimethylphenyl)-3-(4,4-dimethylcyclohexyl)propoxy]-triethylsilane |
| SMILES | CC[Si](CC)(CC)OC(CCC1CCC(C)(C)CC1)c1c(C)cc(C)cc1Cl |
| InChI | InChI=1S/C25H43ClOSi/c1-8-28(9-2,10-3)27-23(24-20(5)17-19(4)18-22(24)26)12-11-21-13-15-25(6,7)16-14-21/h17-18,21,23H,8-16H2,1-7H3 |
| InChIKey | BYUBDMJVFGDVHU-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.16 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [1-(2-chloro-4,6-dimethylphenyl)-3-(4,4-dimethylcyclohexyl)propoxy]-triethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2-chloro-4,6-dimethylphenyl)-3-(4,4-dimethylcyclohexyl)propoxy]-triethylsilane?
The IUPAC name of [1-(2-chloro-4,6-dimethylphenyl)-3-(4,4-dimethylcyclohexyl)propoxy]-triethylsilane (CID 158762913) is [1-(2-chloro-4,6-dimethylphenyl)-3-(4,4-dimethylcyclohexyl)propoxy]-triethylsilane.
What is the SMILES notation for [1-(2-chloro-4,6-dimethylphenyl)-3-(4,4-dimethylcyclohexyl)propoxy]-triethylsilane?
The canonical SMILES for [1-(2-chloro-4,6-dimethylphenyl)-3-(4,4-dimethylcyclohexyl)propoxy]-triethylsilane is CC[Si](CC)(CC)OC(CCC1CCC(C)(C)CC1)c1c(C)cc(C)cc1Cl.
What is the InChIKey of [1-(2-chloro-4,6-dimethylphenyl)-3-(4,4-dimethylcyclohexyl)propoxy]-triethylsilane?
The InChIKey is BYUBDMJVFGDVHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H43ClOSi/c1-8-28(9-2,10-3)27-23(24-20(5)17-19(4)18-22(24)26)12-11-21-13-15-25(6,7)16-14-21/h17-18,21,23H,8-16H2,1-7H3.
What are the key properties of [1-(2-chloro-4,6-dimethylphenyl)-3-(4,4-dimethylcyclohexyl)propoxy]-triethylsilane?
[1-(2-chloro-4,6-dimethylphenyl)-3-(4,4-dimethylcyclohexyl)propoxy]-triethylsilane has a molecular weight of 423.16 g/mol, XLogP of 9.02, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2-chloro-4,6-dimethylphenyl)-3-(4,4-dimethylcyclohexyl)propoxy]-triethylsilane is sourced from PubChem (CID 158762913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).