C25H21ClF9N3O5 — CID 158765134
N-[4-[[4-ethyl-3-[3-methoxy-4-(trifluoromethoxy)phenyl]-6-oxo-4,5-dihydropyridazin-1-yl]methyl]phenyl]-2,2,2-trifluoroacetamide;2,2,2-trifluoroacetyl chloride (PubChem CID 158765134) has the molecular formula C25H21ClF9N3O5 and a molecular weight of 649.89 g/mol. Its IUPAC name is N-[4-[[4-ethyl-3-[3-methoxy-4-(trifluoromethoxy)phenyl]-6-oxo-4,5-dihydropyridazin-1-yl]methyl]phenyl]-2,2,2-trifluoroacetamide;2,2,2-trifluoroacetyl chloride.
| Compound Name | N-[4-[[4-ethyl-3-[3-methoxy-4-(trifluoromethoxy)phenyl]-6-oxo-4,5-dihydropyridazin-1-yl]methyl]phenyl]-2,2,2-trifluoroacetamide;2,2,2-trifluoroacetyl chloride |
|---|---|
| PubChem CID | 158765134 |
| Molecular Formula | C25H21ClF9N3O5 |
| Molecular Weight | 649.89 g/mol |
| Exact Mass | 649.10 |
| IUPAC Name | N-[4-[[4-ethyl-3-[3-methoxy-4-(trifluoromethoxy)phenyl]-6-oxo-4,5-dihydropyridazin-1-yl]methyl]phenyl]-2,2,2-trifluoroacetamide;2,2,2-trifluoroacetyl chloride |
| SMILES | CCC1CC(=O)N(Cc2ccc(NC(=O)C(F)(F)F)cc2)N=C1c1ccc(OC(F)(F)F)c(OC)c1.O=C(Cl)C(F)(F)F |
| InChI | InChI=1S/C23H21F6N3O4.C2ClF3O/c1-3-14-11-19(33)32(12-13-4-7-16(8-5-13)30-21(34)22(24,25)26)31-20(14)15-6-9-17(18(10-15)35-2)36-23(27,28)29;3-1(7)2(4,5)6/h4-10,14H,3,11-12H2,1-2H3,(H,30,34); |
| InChIKey | IPDVQYOEWLNJQS-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.89 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|