C20H22ClN5O2S — CID 158765440
6-(3-chloro-2-methylphenyl)-4-N-[3-(6-methylsulfonyl-3-pyridinyl)propyl]pyrimidine-2,4-diamine (PubChem CID 158765440) has the molecular formula C20H22ClN5O2S and a molecular weight of 431.95 g/mol. Its IUPAC name is 6-(3-chloro-2-methylphenyl)-4-N-[3-(6-methylsulfonyl-3-pyridinyl)propyl]pyrimidine-2,4-diamine.
| Compound Name | 6-(3-chloro-2-methylphenyl)-4-N-[3-(6-methylsulfonyl-3-pyridinyl)propyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 158765440 |
| Molecular Formula | C20H22ClN5O2S |
| Molecular Weight | 431.95 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 6-(3-chloro-2-methylphenyl)-4-N-[3-(6-methylsulfonyl-3-pyridinyl)propyl]pyrimidine-2,4-diamine |
| SMILES | Cc1c(Cl)cccc1-c1cc(NCCCc2ccc(S(C)(=O)=O)nc2)nc(N)n1 |
| InChI | InChI=1S/C20H22ClN5O2S/c1-13-15(6-3-7-16(13)21)17-11-18(26-20(22)25-17)23-10-4-5-14-8-9-19(24-12-14)29(2,27)28/h3,6-9,11-12H,4-5,10H2,1-2H3,(H3,22,23,25,26) |
| InChIKey | HMSXXZDSZPFVEB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.95 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|