C14H18O5 — CID 158765593
ethyl (3aS,5aS,9aR)-3a-hydroxy-2-oxo-3,4,5,5a,6,9-hexahydroindeno[7a,1-b]furan-3-carboxylate (PubChem CID 158765593) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is ethyl (3aS,5aS,9aR)-3a-hydroxy-2-oxo-3,4,5,5a,6,9-hexahydroindeno[7a,1-b]furan-3-carboxylate.
| Compound Name | ethyl (3aS,5aS,9aR)-3a-hydroxy-2-oxo-3,4,5,5a,6,9-hexahydroindeno[7a,1-b]furan-3-carboxylate |
|---|---|
| PubChem CID | 158765593 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | ethyl (3aS,5aS,9aR)-3a-hydroxy-2-oxo-3,4,5,5a,6,9-hexahydroindeno[7a,1-b]furan-3-carboxylate |
| SMILES | CCOC(=O)C1C(=O)O[C@]23CC=CC[C@@H]2CC[C@]13O |
| InChI | InChI=1S/C14H18O5/c1-2-18-11(15)10-12(16)19-14-7-4-3-5-9(14)6-8-13(10,14)17/h3-4,9-10,17H,2,5-8H2,1H3/t9-,10?,13+,14-/m1/s1 |
| InChIKey | IPFICRBWHUMYPH-CICGMFIASA-N |
| XLogP | 0.95 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|