About 2H-1,3-benzothiazol-4-imine
2H-1,3-benzothiazol-4-imine (PubChem CID 158765669) has the molecular formula C7H6N2S
and a molecular weight of 150.21 g/mol. Its IUPAC name is 2H-1,3-benzothiazol-4-imine.
Molecular Properties
| Compound Name | 2H-1,3-benzothiazol-4-imine |
| PubChem CID | 158765669 |
| Molecular Formula | C7H6N2S |
| Molecular Weight | 150.21 g/mol |
| Exact Mass | 150.03 |
| IUPAC Name | 2H-1,3-benzothiazol-4-imine |
| SMILES | [H]/N=C1\C=CC=C2SCN=C21 |
| InChI | InChI=1S/C7H6N2S/c8-5-2-1-3-6-7(5)9-4-10-6/h1-3,8H,4H2/b8-5+ |
| InChIKey | IPFNVMYSKKOLIM-VMPITWQZSA-N |
| XLogP | 1.61 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.21 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2H-1,3-benzothiazol-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-1,3-benzothiazol-4-imine?
The IUPAC name of 2H-1,3-benzothiazol-4-imine (CID 158765669) is 2H-1,3-benzothiazol-4-imine.
What is the SMILES notation for 2H-1,3-benzothiazol-4-imine?
The canonical SMILES for 2H-1,3-benzothiazol-4-imine is [H]/N=C1\C=CC=C2SCN=C21.
What is the InChIKey of 2H-1,3-benzothiazol-4-imine?
The InChIKey is IPFNVMYSKKOLIM-VMPITWQZSA-N. The full InChI is InChI=1S/C7H6N2S/c8-5-2-1-3-6-7(5)9-4-10-6/h1-3,8H,4H2/b8-5+.
What are the key properties of 2H-1,3-benzothiazol-4-imine?
2H-1,3-benzothiazol-4-imine has a molecular weight of 150.21 g/mol, XLogP of 1.61, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-1,3-benzothiazol-4-imine is sourced from PubChem (CID 158765669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).