About 4-(2-methylsulfonylethyl)piperidine;4-(methylsulfonylmethyl)piperidine
4-(2-methylsulfonylethyl)piperidine;4-(methylsulfonylmethyl)piperidine (PubChem CID 158767557) has the molecular formula C15H32N2O4S2
and a molecular weight of 368.57 g/mol. Its IUPAC name is 4-(2-methylsulfonylethyl)piperidine;4-(methylsulfonylmethyl)piperidine.
Molecular Properties
| Compound Name | 4-(2-methylsulfonylethyl)piperidine;4-(methylsulfonylmethyl)piperidine |
| PubChem CID | 158767557 |
| Molecular Formula | C15H32N2O4S2 |
| Molecular Weight | 368.57 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 4-(2-methylsulfonylethyl)piperidine;4-(methylsulfonylmethyl)piperidine |
| SMILES | CS(=O)(=O)CC1CCNCC1.CS(=O)(=O)CCC1CCNCC1 |
| InChI | InChI=1S/C8H17NO2S.C7H15NO2S/c1-12(10,11)7-4-8-2-5-9-6-3-8;1-11(9,10)6-7-2-4-8-5-3-7/h8-9H,2-7H2,1H3;7-8H,2-6H2,1H3 |
| InChIKey | IPLKASRHFICHLU-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.57 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(2-methylsulfonylethyl)piperidine;4-(methylsulfonylmethyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methylsulfonylethyl)piperidine;4-(methylsulfonylmethyl)piperidine?
The IUPAC name of 4-(2-methylsulfonylethyl)piperidine;4-(methylsulfonylmethyl)piperidine (CID 158767557) is 4-(2-methylsulfonylethyl)piperidine;4-(methylsulfonylmethyl)piperidine.
What is the SMILES notation for 4-(2-methylsulfonylethyl)piperidine;4-(methylsulfonylmethyl)piperidine?
The canonical SMILES for 4-(2-methylsulfonylethyl)piperidine;4-(methylsulfonylmethyl)piperidine is CS(=O)(=O)CC1CCNCC1.CS(=O)(=O)CCC1CCNCC1.
What is the InChIKey of 4-(2-methylsulfonylethyl)piperidine;4-(methylsulfonylmethyl)piperidine?
The InChIKey is IPLKASRHFICHLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO2S.C7H15NO2S/c1-12(10,11)7-4-8-2-5-9-6-3-8;1-11(9,10)6-7-2-4-8-5-3-7/h8-9H,2-7H2,1H3;7-8H,2-6H2,1H3.
What are the key properties of 4-(2-methylsulfonylethyl)piperidine;4-(methylsulfonylmethyl)piperidine?
4-(2-methylsulfonylethyl)piperidine;4-(methylsulfonylmethyl)piperidine has a molecular weight of 368.57 g/mol, XLogP of 0.45, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methylsulfonylethyl)piperidine;4-(methylsulfonylmethyl)piperidine is sourced from PubChem (CID 158767557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).