C36H26Cl4F6N2O5 — CID 158768219
4-[3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-enoyl]-2-methylbenzamide;4-[3-(3,5-dichlorophenyl)-4,4,4-trifluoro-3-hydroxybutanoyl]-2-methylbenzamide (PubChem CID 158768219) has the molecular formula C36H26Cl4F6N2O5 and a molecular weight of 822.41 g/mol. Its IUPAC name is 4-[3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-enoyl]-2-methylbenzamide;4-[3-(3,5-dichlorophenyl)-4,4,4-trifluoro-3-hydroxybutanoyl]-2-methylbenzamide.
| Compound Name | 4-[3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-enoyl]-2-methylbenzamide;4-[3-(3,5-dichlorophenyl)-4,4,4-trifluoro-3-hydroxybutanoyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 158768219 |
| Molecular Formula | C36H26Cl4F6N2O5 |
| Molecular Weight | 822.41 g/mol |
| Exact Mass | 820.05 |
| IUPAC Name | 4-[3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-enoyl]-2-methylbenzamide;4-[3-(3,5-dichlorophenyl)-4,4,4-trifluoro-3-hydroxybutanoyl]-2-methylbenzamide |
| SMILES | Cc1cc(C(=O)C=C(c2cc(Cl)cc(Cl)c2)C(F)(F)F)ccc1C(N)=O.Cc1cc(C(=O)CC(O)(c2cc(Cl)cc(Cl)c2)C(F)(F)F)ccc1C(N)=O |
| InChI | InChI=1S/C18H14Cl2F3NO3.C18H12Cl2F3NO2/c1-9-4-10(2-3-14(9)16(24)26)15(25)8-17(27,18(21,22)23)11-5-12(19)7-13(20)6-11;1-9-4-10(2-3-14(9)17(24)26)16(25)8-15(18(21,22)23)11-5-12(19)7-13(20)6-11/h2-7,27H,8H2,1H3,(H2,24,26);2-8H,1H3,(H2,24,26) |
| InChIKey | IPNLDTBNQNJMKY-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 140.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.41 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|