About dimethyl 2-methylidenebutanedioate;methyl 5-oxopyrrolidine-3-carboxylate
dimethyl 2-methylidenebutanedioate;methyl 5-oxopyrrolidine-3-carboxylate (PubChem CID 158768985) has the molecular formula C13H19NO7
and a molecular weight of 301.30 g/mol. Its IUPAC name is dimethyl 2-methylidenebutanedioate;methyl 5-oxopyrrolidine-3-carboxylate.
Molecular Properties
| Compound Name | dimethyl 2-methylidenebutanedioate;methyl 5-oxopyrrolidine-3-carboxylate |
| PubChem CID | 158768985 |
| Molecular Formula | C13H19NO7 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | dimethyl 2-methylidenebutanedioate;methyl 5-oxopyrrolidine-3-carboxylate |
| SMILES | C=C(CC(=O)OC)C(=O)OC.COC(=O)C1CNC(=O)C1 |
| InChI | InChI=1S/C7H10O4.C6H9NO3/c1-5(7(9)11-3)4-6(8)10-2;1-10-6(9)4-2-5(8)7-3-4/h1,4H2,2-3H3;4H,2-3H2,1H3,(H,7,8) |
| InChIKey | IPPZIMLPWZWZAM-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-methylidenebutanedioate;methyl 5-oxopyrrolidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-methylidenebutanedioate;methyl 5-oxopyrrolidine-3-carboxylate?
The IUPAC name of dimethyl 2-methylidenebutanedioate;methyl 5-oxopyrrolidine-3-carboxylate (CID 158768985) is dimethyl 2-methylidenebutanedioate;methyl 5-oxopyrrolidine-3-carboxylate.
What is the SMILES notation for dimethyl 2-methylidenebutanedioate;methyl 5-oxopyrrolidine-3-carboxylate?
The canonical SMILES for dimethyl 2-methylidenebutanedioate;methyl 5-oxopyrrolidine-3-carboxylate is C=C(CC(=O)OC)C(=O)OC.COC(=O)C1CNC(=O)C1.
What is the InChIKey of dimethyl 2-methylidenebutanedioate;methyl 5-oxopyrrolidine-3-carboxylate?
The InChIKey is IPPZIMLPWZWZAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O4.C6H9NO3/c1-5(7(9)11-3)4-6(8)10-2;1-10-6(9)4-2-5(8)7-3-4/h1,4H2,2-3H3;4H,2-3H2,1H3,(H,7,8).
What are the key properties of dimethyl 2-methylidenebutanedioate;methyl 5-oxopyrrolidine-3-carboxylate?
dimethyl 2-methylidenebutanedioate;methyl 5-oxopyrrolidine-3-carboxylate has a molecular weight of 301.30 g/mol, XLogP of -0.43, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-methylidenebutanedioate;methyl 5-oxopyrrolidine-3-carboxylate is sourced from PubChem (CID 158768985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).