About methane;methoxymethyl-[[methoxy(methyl)phosphoryl]oxymethyl]-dimethylazanium
methane;methoxymethyl-[[methoxy(methyl)phosphoryl]oxymethyl]-dimethylazanium (PubChem CID 158769019) has the molecular formula C8H23NO4P+
and a molecular weight of 228.25 g/mol. Its IUPAC name is methane;methoxymethyl-[[methoxy(methyl)phosphoryl]oxymethyl]-dimethylazanium.
Molecular Properties
| Compound Name | methane;methoxymethyl-[[methoxy(methyl)phosphoryl]oxymethyl]-dimethylazanium |
| PubChem CID | 158769019 |
| Molecular Formula | C8H23NO4P+ |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | methane;methoxymethyl-[[methoxy(methyl)phosphoryl]oxymethyl]-dimethylazanium |
| SMILES | C.COC[N+](C)(C)COP(C)(=O)OC |
| InChI | InChI=1S/C7H19NO4P.CH4/c1-8(2,6-10-3)7-12-13(5,9)11-4;/h6-7H2,1-5H3;1H4/q+1; |
| InChIKey | IPQBVOJTHVGNOF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze methane;methoxymethyl-[[methoxy(methyl)phosphoryl]oxymethyl]-dimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;methoxymethyl-[[methoxy(methyl)phosphoryl]oxymethyl]-dimethylazanium?
The IUPAC name of methane;methoxymethyl-[[methoxy(methyl)phosphoryl]oxymethyl]-dimethylazanium (CID 158769019) is methane;methoxymethyl-[[methoxy(methyl)phosphoryl]oxymethyl]-dimethylazanium.
What is the SMILES notation for methane;methoxymethyl-[[methoxy(methyl)phosphoryl]oxymethyl]-dimethylazanium?
The canonical SMILES for methane;methoxymethyl-[[methoxy(methyl)phosphoryl]oxymethyl]-dimethylazanium is C.COC[N+](C)(C)COP(C)(=O)OC.
What is the InChIKey of methane;methoxymethyl-[[methoxy(methyl)phosphoryl]oxymethyl]-dimethylazanium?
The InChIKey is IPQBVOJTHVGNOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H19NO4P.CH4/c1-8(2,6-10-3)7-12-13(5,9)11-4;/h6-7H2,1-5H3;1H4/q+1;.
What are the key properties of methane;methoxymethyl-[[methoxy(methyl)phosphoryl]oxymethyl]-dimethylazanium?
methane;methoxymethyl-[[methoxy(methyl)phosphoryl]oxymethyl]-dimethylazanium has a molecular weight of 228.25 g/mol, XLogP of 1.75, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methane;methoxymethyl-[[methoxy(methyl)phosphoryl]oxymethyl]-dimethylazanium is sourced from PubChem (CID 158769019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).