C13H16O5 — CID 15876948
7-butyl-2,2-dimethylpyrano[4,3-d][1,3]dioxine-4,5-dione (PubChem CID 15876948) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is 7-butyl-2,2-dimethylpyrano[4,3-d][1,3]dioxine-4,5-dione.
| Compound Name | 7-butyl-2,2-dimethylpyrano[4,3-d][1,3]dioxine-4,5-dione |
|---|---|
| PubChem CID | 15876948 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 7-butyl-2,2-dimethylpyrano[4,3-d][1,3]dioxine-4,5-dione |
| SMILES | CCCCc1cc2c(c(=O)o1)C(=O)OC(C)(C)O2 |
| InChI | InChI=1S/C13H16O5/c1-4-5-6-8-7-9-10(11(14)16-8)12(15)18-13(2,3)17-9/h7H,4-6H2,1-3H3 |
| InChIKey | IMBVCVULERVLJG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |