C43H42BrClN2O6 — CID 158769633
9H-fluoren-9-ylmethyl (3R)-3-(2-bromoacetyl)piperidine-1-carboxylate;9H-fluoren-9-ylmethyl (3R)-3-carbonochloridoylpiperidine-1-carboxylate (PubChem CID 158769633) has the molecular formula C43H42BrClN2O6 and a molecular weight of 798.17 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (3R)-3-(2-bromoacetyl)piperidine-1-carboxylate;9H-fluoren-9-ylmethyl (3R)-3-carbonochloridoylpiperidine-1-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl (3R)-3-(2-bromoacetyl)piperidine-1-carboxylate;9H-fluoren-9-ylmethyl (3R)-3-carbonochloridoylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 158769633 |
| Molecular Formula | C43H42BrClN2O6 |
| Molecular Weight | 798.17 g/mol |
| Exact Mass | 796.19 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (3R)-3-(2-bromoacetyl)piperidine-1-carboxylate;9H-fluoren-9-ylmethyl (3R)-3-carbonochloridoylpiperidine-1-carboxylate |
| SMILES | O=C(CBr)[C@@H]1CCCN(C(=O)OCC2c3ccccc3-c3ccccc32)C1.O=C(Cl)[C@@H]1CCCN(C(=O)OCC2c3ccccc3-c3ccccc32)C1 |
| InChI | InChI=1S/C22H22BrNO3.C21H20ClNO3/c23-12-21(25)15-6-5-11-24(13-15)22(26)27-14-20-18-9-3-1-7-16(18)17-8-2-4-10-19(17)20;22-20(24)14-6-5-11-23(12-14)21(25)26-13-19-17-9-3-1-7-15(17)16-8-2-4-10-18(16)19/h1-4,7-10,15,20H,5-6,11-14H2;1-4,7-10,14,19H,5-6,11-13H2/t15-;14-/m11/s1 |
| InChIKey | IPRXBNYGTLUPEA-DNYRVLSESA-N |
| XLogP | 9.02 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.17 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|