C119H102O6S — CID 158769902
bis(1-methyldibenzofuran);bis(2-methyldibenzofuran);3-methyldibenzofuran;4-methyldibenzofuran;4-methyldibenzothiophene;toluene (PubChem CID 158769902) has the molecular formula C119H102O6S and a molecular weight of 1660.19 g/mol. Its IUPAC name is bis(1-methyldibenzofuran);bis(2-methyldibenzofuran);3-methyldibenzofuran;4-methyldibenzofuran;4-methyldibenzothiophene;toluene.
| Compound Name | bis(1-methyldibenzofuran);bis(2-methyldibenzofuran);3-methyldibenzofuran;4-methyldibenzofuran;4-methyldibenzothiophene;toluene |
|---|---|
| PubChem CID | 158769902 |
| Molecular Formula | C119H102O6S |
| Molecular Weight | 1660.19 g/mol |
| Exact Mass | 1658.74 |
| IUPAC Name | bis(1-methyldibenzofuran);bis(2-methyldibenzofuran);3-methyldibenzofuran;4-methyldibenzofuran;4-methyldibenzothiophene;toluene |
| SMILES | Cc1ccc2c(c1)oc1ccccc12.Cc1ccc2oc3ccccc3c2c1.Cc1ccc2oc3ccccc3c2c1.Cc1cccc2c1oc1ccccc12.Cc1cccc2c1sc1ccccc12.Cc1cccc2oc3ccccc3c12.Cc1cccc2oc3ccccc3c12.Cc1ccccc1.Cc1ccccc1.Cc1ccccc1.Cc1ccccc1 |
| InChI | InChI=1S/6C13H10O.C13H10S.4C7H8/c1-9-5-4-7-11-10-6-2-3-8-12(10)14-13(9)11;2*1-9-5-4-8-12-13(9)10-6-2-3-7-11(10)14-12;2*1-9-6-7-13-11(8-9)10-4-2-3-5-12(10)14-13;1-9-6-7-11-10-4-2-3-5-12(10)14-13(11)8-9;1-9-5-4-7-11-10-6-2-3-8-12(10)14-13(9)11;4*1-7-5-3-2-4-6-7/h7*2-8H,1H3;4*2-6H,1H3 |
| InChIKey | IPSRTQYVJKMWFI-UHFFFAOYSA-N |
| XLogP | 35.71 |
| TPSA | 78.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 126 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1660.19 |
| LogP ≤ 5 | 35.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |