C13H18N2O — CID 15876995
1-hydroxy-4,4,5,5-tetramethyl-2-phenylimidazole (PubChem CID 15876995) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 1-hydroxy-4,4,5,5-tetramethyl-2-phenylimidazole.
| Compound Name | 1-hydroxy-4,4,5,5-tetramethyl-2-phenylimidazole |
|---|---|
| PubChem CID | 15876995 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 1-hydroxy-4,4,5,5-tetramethyl-2-phenylimidazole |
| SMILES | CC1(C)N=C(c2ccccc2)N(O)C1(C)C |
| InChI | InChI=1S/C13H18N2O/c1-12(2)13(3,4)15(16)11(14-12)10-8-6-5-7-9-10/h5-9,16H,1-4H3 |
| InChIKey | ZIMVUBZVBDQGEU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |