About zinc;2-ethyl-3-hydroxypyran-4-one;1-ethyl-3-hydroxypyridin-2-one
zinc;2-ethyl-3-hydroxypyran-4-one;1-ethyl-3-hydroxypyridin-2-one (PubChem CID 158770174) has the molecular formula C14H17NO5Zn+2
and a molecular weight of 344.68 g/mol. Its IUPAC name is zinc;2-ethyl-3-hydroxypyran-4-one;1-ethyl-3-hydroxypyridin-2-one.
Molecular Properties
| Compound Name | zinc;2-ethyl-3-hydroxypyran-4-one;1-ethyl-3-hydroxypyridin-2-one |
| PubChem CID | 158770174 |
| Molecular Formula | C14H17NO5Zn+2 |
| Molecular Weight | 344.68 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | zinc;2-ethyl-3-hydroxypyran-4-one;1-ethyl-3-hydroxypyridin-2-one |
| SMILES | CCc1occc(=O)c1O.CCn1cccc(O)c1=O.[Zn+2] |
| InChI | InChI=1S/C7H9NO2.C7H8O3.Zn/c1-2-8-5-3-4-6(9)7(8)10;1-2-6-7(9)5(8)3-4-10-6;/h3-5,9H,2H2,1H3;3-4,9H,2H2,1H3;/q;;+2 |
| InChIKey | IPTODZNJXIDMKP-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.68 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;2-ethyl-3-hydroxypyran-4-one;1-ethyl-3-hydroxypyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;2-ethyl-3-hydroxypyran-4-one;1-ethyl-3-hydroxypyridin-2-one?
The IUPAC name of zinc;2-ethyl-3-hydroxypyran-4-one;1-ethyl-3-hydroxypyridin-2-one (CID 158770174) is zinc;2-ethyl-3-hydroxypyran-4-one;1-ethyl-3-hydroxypyridin-2-one.
What is the SMILES notation for zinc;2-ethyl-3-hydroxypyran-4-one;1-ethyl-3-hydroxypyridin-2-one?
The canonical SMILES for zinc;2-ethyl-3-hydroxypyran-4-one;1-ethyl-3-hydroxypyridin-2-one is CCc1occc(=O)c1O.CCn1cccc(O)c1=O.[Zn+2].
What is the InChIKey of zinc;2-ethyl-3-hydroxypyran-4-one;1-ethyl-3-hydroxypyridin-2-one?
The InChIKey is IPTODZNJXIDMKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2.C7H8O3.Zn/c1-2-8-5-3-4-6(9)7(8)10;1-2-6-7(9)5(8)3-4-10-6;/h3-5,9H,2H2,1H3;3-4,9H,2H2,1H3;/q;;+2.
What are the key properties of zinc;2-ethyl-3-hydroxypyran-4-one;1-ethyl-3-hydroxypyridin-2-one?
zinc;2-ethyl-3-hydroxypyran-4-one;1-ethyl-3-hydroxypyridin-2-one has a molecular weight of 344.68 g/mol, XLogP of 1.48, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;2-ethyl-3-hydroxypyran-4-one;1-ethyl-3-hydroxypyridin-2-one is sourced from PubChem (CID 158770174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).