C38H38ClN7O7 — CID 158771112
N-[4-(3-chloro-4-ethynylphenoxy)cyclohexyl]-6-[4-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyethyl]piperazin-1-yl]pyridazine-3-carboxamide (PubChem CID 158771112) has the molecular formula C38H38ClN7O7 and a molecular weight of 740.22 g/mol. Its IUPAC name is N-[4-(3-chloro-4-ethynylphenoxy)cyclohexyl]-6-[4-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyethyl]piperazin-1-yl]pyridazine-3-carboxamide.
| Compound Name | N-[4-(3-chloro-4-ethynylphenoxy)cyclohexyl]-6-[4-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyethyl]piperazin-1-yl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 158771112 |
| Molecular Formula | C38H38ClN7O7 |
| Molecular Weight | 740.22 g/mol |
| Exact Mass | 739.25 |
| IUPAC Name | N-[4-(3-chloro-4-ethynylphenoxy)cyclohexyl]-6-[4-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyethyl]piperazin-1-yl]pyridazine-3-carboxamide |
| SMILES | C#Cc1ccc(OC2CCC(NC(=O)c3ccc(N4CCN(CCOc5ccc6c(c5)C(=O)N(C5CCC(=O)NC5=O)C6=O)CC4)nn3)CC2)cc1Cl |
| InChI | InChI=1S/C38H38ClN7O7/c1-2-23-3-6-27(22-30(23)39)53-25-7-4-24(5-8-25)40-35(48)31-11-13-33(43-42-31)45-17-15-44(16-18-45)19-20-52-26-9-10-28-29(21-26)38(51)46(37(28)50)32-12-14-34(47)41-36(32)49/h1,3,6,9-11,13,21-22,24-25,32H,4-5,7-8,12,14-20H2,(H,40,48)(H,41,47,49) |
| InChIKey | TUUVKDXJJGDWGM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 163.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.22 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|