C24H37N9O2 — CID 158771962
1,4-dimethylimidazole;2,4-dimethyl-1,3-oxazole;2,5-dimethyl-1,3-oxazole;1,3-dimethylpyrazole;1,3-dimethyl-1,2,4-triazole (PubChem CID 158771962) has the molecular formula C24H37N9O2 and a molecular weight of 483.62 g/mol. Its IUPAC name is 1,4-dimethylimidazole;2,4-dimethyl-1,3-oxazole;2,5-dimethyl-1,3-oxazole;1,3-dimethylpyrazole;1,3-dimethyl-1,2,4-triazole.
| Compound Name | 1,4-dimethylimidazole;2,4-dimethyl-1,3-oxazole;2,5-dimethyl-1,3-oxazole;1,3-dimethylpyrazole;1,3-dimethyl-1,2,4-triazole |
|---|---|
| PubChem CID | 158771962 |
| Molecular Formula | C24H37N9O2 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.31 |
| IUPAC Name | 1,4-dimethylimidazole;2,4-dimethyl-1,3-oxazole;2,5-dimethyl-1,3-oxazole;1,3-dimethylpyrazole;1,3-dimethyl-1,2,4-triazole |
| SMILES | Cc1ccn(C)n1.Cc1cn(C)cn1.Cc1cnc(C)o1.Cc1coc(C)n1.Cc1ncn(C)n1 |
| InChI | InChI=1S/2C5H8N2.2C5H7NO.C4H7N3/c1-5-3-7(2)4-6-5;1-5-3-4-7(2)6-5;1-4-3-7-5(2)6-4;1-4-3-6-5(2)7-4;1-4-5-3-7(2)6-4/h2*3-4H,1-2H3;3*3H,1-2H3 |
| InChIKey | IPZFOZNAYKPMNR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 118.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |