About ethene;bis(pyrrole-2,5-dione)
ethene;bis(pyrrole-2,5-dione) (PubChem CID 158772678) has the molecular formula C10H10N2O4
and a molecular weight of 222.20 g/mol. Its IUPAC name is ethene;bis(pyrrole-2,5-dione).
Molecular Properties
| Compound Name | ethene;bis(pyrrole-2,5-dione) |
| PubChem CID | 158772678 |
| Molecular Formula | C10H10N2O4 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | ethene;bis(pyrrole-2,5-dione) |
| SMILES | C=C.O=C1C=CC(=O)N1.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/2C4H3NO2.C2H4/c2*6-3-1-2-4(7)5-3;1-2/h2*1-2H,(H,5,6,7);1-2H2 |
| InChIKey | IQBLYMCFIBYFFT-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethene;bis(pyrrole-2,5-dione) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;bis(pyrrole-2,5-dione)?
The IUPAC name of ethene;bis(pyrrole-2,5-dione) (CID 158772678) is ethene;bis(pyrrole-2,5-dione).
What is the SMILES notation for ethene;bis(pyrrole-2,5-dione)?
The canonical SMILES for ethene;bis(pyrrole-2,5-dione) is C=C.O=C1C=CC(=O)N1.O=C1C=CC(=O)N1.
What is the InChIKey of ethene;bis(pyrrole-2,5-dione)?
The InChIKey is IQBLYMCFIBYFFT-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H3NO2.C2H4/c2*6-3-1-2-4(7)5-3;1-2/h2*1-2H,(H,5,6,7);1-2H2.
What are the key properties of ethene;bis(pyrrole-2,5-dione)?
ethene;bis(pyrrole-2,5-dione) has a molecular weight of 222.20 g/mol, XLogP of -0.80, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;bis(pyrrole-2,5-dione) is sourced from PubChem (CID 158772678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).