C13H4N18O13 — CID 158773848
1,5-diazido-2,3,4-trinitrobenzene;1,2-diazido-3-(trinitromethoxy)benzene (PubChem CID 158773848) has the molecular formula C13H4N18O13 and a molecular weight of 620.29 g/mol. Its IUPAC name is 1,5-diazido-2,3,4-trinitrobenzene;1,2-diazido-3-(trinitromethoxy)benzene.
| Compound Name | 1,5-diazido-2,3,4-trinitrobenzene;1,2-diazido-3-(trinitromethoxy)benzene |
|---|---|
| PubChem CID | 158773848 |
| Molecular Formula | C13H4N18O13 |
| Molecular Weight | 620.29 g/mol |
| Exact Mass | 620.02 |
| IUPAC Name | 1,5-diazido-2,3,4-trinitrobenzene;1,2-diazido-3-(trinitromethoxy)benzene |
| SMILES | [N-]=[N+]=Nc1cc(N=[N+]=[N-])c([N+](=O)[O-])c([N+](=O)[O-])c1[N+](=O)[O-].[N-]=[N+]=Nc1cccc(OC([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])c1N=[N+]=[N-] |
| InChI | InChI=1S/C7H3N9O7.C6HN9O6/c8-12-10-4-2-1-3-5(6(4)11-13-9)23-7(14(17)18,15(19)20)16(21)22;7-11-9-2-1-3(10-12-8)5(14(18)19)6(15(20)21)4(2)13(16)17/h1-3H;1H |
| InChIKey | IQFKBMQPUDHIDJ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 463.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.29 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|