About thiophen-3-ylmethyl but-3-enoate;thiophen-3-ylmethyl 2-trichlorosilylacetate
thiophen-3-ylmethyl but-3-enoate;thiophen-3-ylmethyl 2-trichlorosilylacetate (PubChem CID 158774051) has the molecular formula C16H17Cl3O4S2Si
and a molecular weight of 471.89 g/mol. Its IUPAC name is thiophen-3-ylmethyl but-3-enoate;thiophen-3-ylmethyl 2-trichlorosilylacetate.
Molecular Properties
| Compound Name | thiophen-3-ylmethyl but-3-enoate;thiophen-3-ylmethyl 2-trichlorosilylacetate |
| PubChem CID | 158774051 |
| Molecular Formula | C16H17Cl3O4S2Si |
| Molecular Weight | 471.89 g/mol |
| Exact Mass | 469.94 |
| IUPAC Name | thiophen-3-ylmethyl but-3-enoate;thiophen-3-ylmethyl 2-trichlorosilylacetate |
| SMILES | C=CCC(=O)OCc1ccsc1.O=C(C[Si](Cl)(Cl)Cl)OCc1ccsc1 |
| InChI | InChI=1S/C9H10O2S.C7H7Cl3O2SSi/c1-2-3-9(10)11-6-8-4-5-12-7-8;8-14(9,10)5-7(11)12-3-6-1-2-13-4-6/h2,4-5,7H,1,3,6H2;1-2,4H,3,5H2 |
| InChIKey | IQGCLUHRQUGDCV-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 471.89 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze thiophen-3-ylmethyl but-3-enoate;thiophen-3-ylmethyl 2-trichlorosilylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiophen-3-ylmethyl but-3-enoate;thiophen-3-ylmethyl 2-trichlorosilylacetate?
The IUPAC name of thiophen-3-ylmethyl but-3-enoate;thiophen-3-ylmethyl 2-trichlorosilylacetate (CID 158774051) is thiophen-3-ylmethyl but-3-enoate;thiophen-3-ylmethyl 2-trichlorosilylacetate.
What is the SMILES notation for thiophen-3-ylmethyl but-3-enoate;thiophen-3-ylmethyl 2-trichlorosilylacetate?
The canonical SMILES for thiophen-3-ylmethyl but-3-enoate;thiophen-3-ylmethyl 2-trichlorosilylacetate is C=CCC(=O)OCc1ccsc1.O=C(C[Si](Cl)(Cl)Cl)OCc1ccsc1.
What is the InChIKey of thiophen-3-ylmethyl but-3-enoate;thiophen-3-ylmethyl 2-trichlorosilylacetate?
The InChIKey is IQGCLUHRQUGDCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2S.C7H7Cl3O2SSi/c1-2-3-9(10)11-6-8-4-5-12-7-8;8-14(9,10)5-7(11)12-3-6-1-2-13-4-6/h2,4-5,7H,1,3,6H2;1-2,4H,3,5H2.
What are the key properties of thiophen-3-ylmethyl but-3-enoate;thiophen-3-ylmethyl 2-trichlorosilylacetate?
thiophen-3-ylmethyl but-3-enoate;thiophen-3-ylmethyl 2-trichlorosilylacetate has a molecular weight of 471.89 g/mol, XLogP of 5.81, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for thiophen-3-ylmethyl but-3-enoate;thiophen-3-ylmethyl 2-trichlorosilylacetate is sourced from PubChem (CID 158774051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).