C25H26N4O — CID 158774093
7-amino-19-methyl-3-(2-methylpropyl)-3,19,20-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaen-14-one (PubChem CID 158774093) has the molecular formula C25H26N4O and a molecular weight of 398.51 g/mol. Its IUPAC name is 7-amino-19-methyl-3-(2-methylpropyl)-3,19,20-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaen-14-one.
| Compound Name | 7-amino-19-methyl-3-(2-methylpropyl)-3,19,20-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaen-14-one |
|---|---|
| PubChem CID | 158774093 |
| Molecular Formula | C25H26N4O |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 7-amino-19-methyl-3-(2-methylpropyl)-3,19,20-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaen-14-one |
| SMILES | CC(C)Cn1c2ccc(N)cc2c2c3c(c4c(c21)CCc1nn(C)cc1-4)C(=O)CC3 |
| InChI | InChI=1S/C25H26N4O/c1-13(2)11-29-20-8-4-14(26)10-17(20)23-15-6-9-21(30)24(15)22-16(25(23)29)5-7-19-18(22)12-28(3)27-19/h4,8,10,12-13H,5-7,9,11,26H2,1-3H3 |
| InChIKey | ITFCOCMGGSNWHF-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 65.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|