About acetic acid;butyl 3-benzylsulfonyloxy-2-methylpropanoate
acetic acid;butyl 3-benzylsulfonyloxy-2-methylpropanoate (PubChem CID 158774435) has the molecular formula C17H26O7S
and a molecular weight of 374.46 g/mol. Its IUPAC name is acetic acid;butyl 3-benzylsulfonyloxy-2-methylpropanoate.
Molecular Properties
| Compound Name | acetic acid;butyl 3-benzylsulfonyloxy-2-methylpropanoate |
| PubChem CID | 158774435 |
| Molecular Formula | C17H26O7S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | acetic acid;butyl 3-benzylsulfonyloxy-2-methylpropanoate |
| SMILES | CC(=O)O.CCCCOC(=O)C(C)COS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C15H22O5S.C2H4O2/c1-3-4-10-19-15(16)13(2)11-20-21(17,18)12-14-8-6-5-7-9-14;1-2(3)4/h5-9,13H,3-4,10-12H2,1-2H3;1H3,(H,3,4) |
| InChIKey | HFAXEGFRETWXKY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;butyl 3-benzylsulfonyloxy-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;butyl 3-benzylsulfonyloxy-2-methylpropanoate?
The IUPAC name of acetic acid;butyl 3-benzylsulfonyloxy-2-methylpropanoate (CID 158774435) is acetic acid;butyl 3-benzylsulfonyloxy-2-methylpropanoate.
What is the SMILES notation for acetic acid;butyl 3-benzylsulfonyloxy-2-methylpropanoate?
The canonical SMILES for acetic acid;butyl 3-benzylsulfonyloxy-2-methylpropanoate is CC(=O)O.CCCCOC(=O)C(C)COS(=O)(=O)Cc1ccccc1.
What is the InChIKey of acetic acid;butyl 3-benzylsulfonyloxy-2-methylpropanoate?
The InChIKey is HFAXEGFRETWXKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O5S.C2H4O2/c1-3-4-10-19-15(16)13(2)11-20-21(17,18)12-14-8-6-5-7-9-14;1-2(3)4/h5-9,13H,3-4,10-12H2,1-2H3;1H3,(H,3,4).
What are the key properties of acetic acid;butyl 3-benzylsulfonyloxy-2-methylpropanoate?
acetic acid;butyl 3-benzylsulfonyloxy-2-methylpropanoate has a molecular weight of 374.46 g/mol, XLogP of 2.60, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;butyl 3-benzylsulfonyloxy-2-methylpropanoate is sourced from PubChem (CID 158774435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).