C8H12N6 — CID 15877519
1-[4-(1,2,4-triazol-1-yl)butyl]-1,2,4-triazole (PubChem CID 15877519) has the molecular formula C8H12N6 and a molecular weight of 192.23 g/mol. Its IUPAC name is 1-[4-(1,2,4-triazol-1-yl)butyl]-1,2,4-triazole.
| Compound Name | 1-[4-(1,2,4-triazol-1-yl)butyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 15877519 |
| Molecular Formula | C8H12N6 |
| Molecular Weight | 192.23 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 1-[4-(1,2,4-triazol-1-yl)butyl]-1,2,4-triazole |
| SMILES | c1ncn(CCCCn2cncn2)n1 |
| InChI | InChI=1S/C8H12N6/c1(3-13-7-9-5-11-13)2-4-14-8-10-6-12-14/h5-8H,1-4H2 |
| InChIKey | QRCAYFMZDKAPGL-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.23 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|