C10H3F14N3 — CID 15877564
2,4-bis(1,1,2,2,3,3,3-heptafluoropropyl)-6-methyl-1,3,5-triazine (PubChem CID 15877564) has the molecular formula C10H3F14N3 and a molecular weight of 431.13 g/mol. Its IUPAC name is 2,4-bis(1,1,2,2,3,3,3-heptafluoropropyl)-6-methyl-1,3,5-triazine.
| Compound Name | 2,4-bis(1,1,2,2,3,3,3-heptafluoropropyl)-6-methyl-1,3,5-triazine |
|---|---|
| PubChem CID | 15877564 |
| Molecular Formula | C10H3F14N3 |
| Molecular Weight | 431.13 g/mol |
| Exact Mass | 431.01 |
| IUPAC Name | 2,4-bis(1,1,2,2,3,3,3-heptafluoropropyl)-6-methyl-1,3,5-triazine |
| SMILES | Cc1nc(C(F)(F)C(F)(F)C(F)(F)F)nc(C(F)(F)C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C10H3F14N3/c1-2-25-3(5(11,12)7(15,16)9(19,20)21)27-4(26-2)6(13,14)8(17,18)10(22,23)24/h1H3 |
| InChIKey | STIYNAVNQMOGQG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.13 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|