C46H32F6N2O7 — CID 158776332
5-(1,3-dioxoisoindol-5-yl)oxy-2-methylisoindole-1,3-dione;1-[1,1,1,3,3,3-hexafluoro-2-[4-(4-methylphenoxy)phenyl]propan-2-yl]-4-(4-methylphenoxy)benzene (PubChem CID 158776332) has the molecular formula C46H32F6N2O7 and a molecular weight of 838.76 g/mol. Its IUPAC name is 5-(1,3-dioxoisoindol-5-yl)oxy-2-methylisoindole-1,3-dione;1-[1,1,1,3,3,3-hexafluoro-2-[4-(4-methylphenoxy)phenyl]propan-2-yl]-4-(4-methylphenoxy)benzene.
| Compound Name | 5-(1,3-dioxoisoindol-5-yl)oxy-2-methylisoindole-1,3-dione;1-[1,1,1,3,3,3-hexafluoro-2-[4-(4-methylphenoxy)phenyl]propan-2-yl]-4-(4-methylphenoxy)benzene |
|---|---|
| PubChem CID | 158776332 |
| Molecular Formula | C46H32F6N2O7 |
| Molecular Weight | 838.76 g/mol |
| Exact Mass | 838.21 |
| IUPAC Name | 5-(1,3-dioxoisoindol-5-yl)oxy-2-methylisoindole-1,3-dione;1-[1,1,1,3,3,3-hexafluoro-2-[4-(4-methylphenoxy)phenyl]propan-2-yl]-4-(4-methylphenoxy)benzene |
| SMILES | CN1C(=O)c2ccc(Oc3ccc4c(c3)C(=O)NC4=O)cc2C1=O.Cc1ccc(Oc2ccc(C(c3ccc(Oc4ccc(C)cc4)cc3)(C(F)(F)F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C29H22F6O2.C17H10N2O5/c1-19-3-11-23(12-4-19)36-25-15-7-21(8-16-25)27(28(30,31)32,29(33,34)35)22-9-17-26(18-10-22)37-24-13-5-20(2)6-14-24;1-19-16(22)11-5-3-9(7-13(11)17(19)23)24-8-2-4-10-12(6-8)15(21)18-14(10)20/h3-18H,1-2H3;2-7H,1H3,(H,18,20,21) |
| InChIKey | IQNBDBVVFGLMEE-UHFFFAOYSA-N |
| XLogP | 10.89 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.76 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|