C18H32O5Si — CID 158777005
(1S,3R,8R,10S,14S)-6,6-ditert-butyl-14-methyl-2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecan-12-one (PubChem CID 158777005) has the molecular formula C18H32O5Si and a molecular weight of 356.54 g/mol. Its IUPAC name is (1S,3R,8R,10S,14S)-6,6-ditert-butyl-14-methyl-2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecan-12-one.
| Compound Name | (1S,3R,8R,10S,14S)-6,6-ditert-butyl-14-methyl-2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecan-12-one |
|---|---|
| PubChem CID | 158777005 |
| Molecular Formula | C18H32O5Si |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | (1S,3R,8R,10S,14S)-6,6-ditert-butyl-14-methyl-2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecan-12-one |
| SMILES | C[C@H]1CC(=O)O[C@H]2C[C@H]3O[Si](C(C)(C)C)(C(C)(C)C)OC[C@H]3O[C@H]21 |
| InChI | InChI=1S/C18H32O5Si/c1-11-8-15(19)21-13-9-12-14(22-16(11)13)10-20-24(23-12,17(2,3)4)18(5,6)7/h11-14,16H,8-10H2,1-7H3/t11-,12+,13-,14+,16-/m0/s1 |
| InChIKey | RYZCVLDQGUHLBP-QKDZRIPBSA-N |
| XLogP | 3.55 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|